C18H14F5NO4 — CID 7211967
[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-propoxybenzoate (PubChem CID 7211967) has the molecular formula C18H14F5NO4 and a molecular weight of 403.30 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-propoxybenzoate.
| Compound Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 7211967 |
| Molecular Formula | C18H14F5NO4 |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(=O)Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H14F5NO4/c1-2-7-27-10-5-3-9(4-6-10)18(26)28-8-11(25)24-17-15(22)13(20)12(19)14(21)16(17)23/h3-6H,2,7-8H2,1H3,(H,24,25) |
| InChIKey | WRRIGRSJUTXMRA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|