C20H22FNO4 — CID 8863143
[2-(2-fluoro-4-methylanilino)-2-oxoethyl] 4-butoxybenzoate (PubChem CID 8863143) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 4-butoxybenzoate.
| Compound Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 8863143 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)Nc2ccc(C)cc2F)cc1 |
| InChI | InChI=1S/C20H22FNO4/c1-3-4-11-25-16-8-6-15(7-9-16)20(24)26-13-19(23)22-18-10-5-14(2)12-17(18)21/h5-10,12H,3-4,11,13H2,1-2H3,(H,22,23) |
| InChIKey | AVQLZYMOMWDDED-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|