C19H20N2O5 — CID 8678370
[2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate (PubChem CID 8678370) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 8678370 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
| SMILES | Cc1ccc(C)c(NC(=O)COC(=O)c2ccc(OCC(N)=O)cc2)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-12-3-4-13(2)16(9-12)21-18(23)11-26-19(24)14-5-7-15(8-6-14)25-10-17(20)22/h3-9H,10-11H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | CGXPGCQQLPMRPN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |