C21H23N3O5 — CID 46792519
[2-(2,5-dimethylanilino)-2-oxoethyl] 3,5-diacetamidobenzoate (PubChem CID 46792519) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 3,5-diacetamidobenzoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 3,5-diacetamidobenzoate |
|---|---|
| PubChem CID | 46792519 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 3,5-diacetamidobenzoate |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)OCC(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-12-5-6-13(2)19(7-12)24-20(27)11-29-21(28)16-8-17(22-14(3)25)10-18(9-16)23-15(4)26/h5-10H,11H2,1-4H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | ZVHAKWJUSVQEJO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |