C27H27N3O5 — CID 42967572
[2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 3,5-diacetamidobenzoate (PubChem CID 42967572) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 3,5-diacetamidobenzoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 3,5-diacetamidobenzoate |
|---|---|
| PubChem CID | 42967572 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 3,5-diacetamidobenzoate |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)OC(C(=O)Nc2cc(C)ccc2C)c2ccccc2)c1 |
| InChI | InChI=1S/C27H27N3O5/c1-16-10-11-17(2)24(12-16)30-26(33)25(20-8-6-5-7-9-20)35-27(34)21-13-22(28-18(3)31)15-23(14-21)29-19(4)32/h5-15,25H,1-4H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | NJKBTXDMCOUJGI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |