C23H21ClN2O5S — CID 2714655
[(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 2714655) has the molecular formula C23H21ClN2O5S and a molecular weight of 472.95 g/mol. Its IUPAC name is [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 2714655 |
| Molecular Formula | C23H21ClN2O5S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | Cc1ccc(C)c(NC(=O)[C@@H](OC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21ClN2O5S/c1-14-8-9-15(2)19(12-14)26-22(27)21(16-6-4-3-5-7-16)31-23(28)17-10-11-18(24)20(13-17)32(25,29)30/h3-13,21H,1-2H3,(H,26,27)(H2,25,29,30)/t21-/m0/s1 |
| InChIKey | HRLCGWPSVIDVGT-NRFANRHFSA-N |
| XLogP | 4.14 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |