C29H32N2O5S — CID 2497329
[(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-(azepan-1-ylsulfonyl)benzoate (PubChem CID 2497329) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2497329 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [(1S)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-(azepan-1-ylsulfonyl)benzoate |
| SMILES | Cc1ccc(C)c(NC(=O)[C@@H](OC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H32N2O5S/c1-21-12-13-22(2)26(20-21)30-28(32)27(23-10-6-5-7-11-23)36-29(33)24-14-16-25(17-15-24)37(34,35)31-18-8-3-4-9-19-31/h5-7,10-17,20,27H,3-4,8-9,18-19H2,1-2H3,(H,30,32)/t27-/m0/s1 |
| InChIKey | SBANYVXMMBUXQF-MHZLTWQESA-N |
| XLogP | 5.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |