C23H19ClN2O5 — CID 18270511
[2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-nitrobenzoate (PubChem CID 18270511) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 18270511 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 4-chloro-3-nitrobenzoate |
| SMILES | Cc1ccc(C)c(NC(=O)C(OC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H19ClN2O5/c1-14-8-9-15(2)19(12-14)25-22(27)21(16-6-4-3-5-7-16)31-23(28)17-10-11-18(24)20(13-17)26(29)30/h3-13,21H,1-2H3,(H,25,27) |
| InChIKey | YGLMUHLNGCOWRL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|