C22H17N3O7 — CID 18229162
[2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 3-nitrobenzoate (PubChem CID 18229162) has the molecular formula C22H17N3O7 and a molecular weight of 435.39 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 3-nitrobenzoate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 18229162 |
| Molecular Formula | C22H17N3O7 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 3-nitrobenzoate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)c2cccc([N+](=O)[O-])c2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17N3O7/c1-14-10-11-18(19(12-14)25(30)31)23-21(26)20(15-6-3-2-4-7-15)32-22(27)16-8-5-9-17(13-16)24(28)29/h2-13,20H,1H3,(H,23,26) |
| InChIKey | GTBJINNUXHVDKH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|