C29H20N2O8S — CID 98408077
[(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 9,10,10-trioxothioxanthene-3-carboxylate (PubChem CID 98408077) has the molecular formula C29H20N2O8S and a molecular weight of 556.55 g/mol. Its IUPAC name is [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 9,10,10-trioxothioxanthene-3-carboxylate.
| Compound Name | [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
|---|---|
| PubChem CID | 98408077 |
| Molecular Formula | C29H20N2O8S |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 9,10,10-trioxothioxanthene-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@H](OC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H20N2O8S/c1-17-11-14-22(23(15-17)31(35)36)30-28(33)27(18-7-3-2-4-8-18)39-29(34)19-12-13-21-25(16-19)40(37,38)24-10-6-5-9-20(24)26(21)32/h2-16,27H,1H3,(H,30,33)/t27-/m1/s1 |
| InChIKey | NAOOEFOSJRYDDQ-HHHXNRCGSA-N |
| XLogP | 4.82 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|