C23H17N3O5 — CID 7716921
[(1S)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 4-cyanobenzoate (PubChem CID 7716921) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is [(1S)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 4-cyanobenzoate.
| Compound Name | [(1S)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 7716921 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [(1S)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 4-cyanobenzoate |
| SMILES | Cc1ccc(NC(=O)[C@@H](OC(=O)c2ccc(C#N)cc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17N3O5/c1-15-7-12-19(20(13-15)26(29)30)25-22(27)21(17-5-3-2-4-6-17)31-23(28)18-10-8-16(14-24)9-11-18/h2-13,21H,1H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | SNSMIKOVAWCEKS-NRFANRHFSA-N |
| XLogP | 4.31 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|