C24H22N2O7 — CID 42963206
[2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2,3-dimethoxybenzoate (PubChem CID 42963206) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 42963206 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OC(C(=O)Nc2ccc(C)cc2[N+](=O)[O-])c2ccccc2)c1OC |
| InChI | InChI=1S/C24H22N2O7/c1-15-12-13-18(19(14-15)26(29)30)25-23(27)21(16-8-5-4-6-9-16)33-24(28)17-10-7-11-20(31-2)22(17)32-3/h4-14,21H,1-3H3,(H,25,27) |
| InChIKey | IERVXWUENLYLCK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|