C22H21N3O4 — CID 9345172
(2S)-2-(2-methoxyanilino)-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide (PubChem CID 9345172) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is (2S)-2-(2-methoxyanilino)-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-(2-methoxyanilino)-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 9345172 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2S)-2-(2-methoxyanilino)-N-(4-methyl-2-nitrophenyl)-2-phenylacetamide |
| SMILES | COc1ccccc1N[C@H](C(=O)Nc1ccc(C)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C22H21N3O4/c1-15-12-13-17(19(14-15)25(27)28)24-22(26)21(16-8-4-3-5-9-16)23-18-10-6-7-11-20(18)29-2/h3-14,21,23H,1-2H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | LMVXXYKMHIOWHC-NRFANRHFSA-N |
| XLogP | 4.70 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|