C23H20N4O8 — CID 3394012
N,N'-bis(4-methoxy-2-nitrophenyl)-2-phenylpropanediamide (PubChem CID 3394012) has the molecular formula C23H20N4O8 and a molecular weight of 480.43 g/mol. Its IUPAC name is N,N'-bis(4-methoxy-2-nitrophenyl)-2-phenylpropanediamide.
| Compound Name | N,N'-bis(4-methoxy-2-nitrophenyl)-2-phenylpropanediamide |
|---|---|
| PubChem CID | 3394012 |
| Molecular Formula | C23H20N4O8 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N,N'-bis(4-methoxy-2-nitrophenyl)-2-phenylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C(=O)Nc2ccc(OC)cc2[N+](=O)[O-])c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N4O8/c1-34-15-8-10-17(19(12-15)26(30)31)24-22(28)21(14-6-4-3-5-7-14)23(29)25-18-11-9-16(35-2)13-20(18)27(32)33/h3-13,21H,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | HRLSZNVZUWCSPB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|