C16H16N2O4S — CID 2975810
N-(4-methoxy-2-nitrophenyl)-3-phenylsulfanylpropanamide (PubChem CID 2975810) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-3-phenylsulfanylpropanamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 2975810 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-3-phenylsulfanylpropanamide |
| SMILES | COc1ccc(NC(=O)CCSc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N2O4S/c1-22-12-7-8-14(15(11-12)18(20)21)17-16(19)9-10-23-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,17,19) |
| InChIKey | LIYZFDUQRFGEPD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|