C13H16N2O6S — CID 8785649
methyl 3-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 8785649) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is methyl 3-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 8785649 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | methyl 3-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCC(=O)Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O6S/c1-20-9-3-4-10(11(7-9)15(18)19)14-12(16)8-22-6-5-13(17)21-2/h3-4,7H,5-6,8H2,1-2H3,(H,14,16) |
| InChIKey | JKGAXMHSELXOAK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|