4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid

C13H16N2O6 — CID 103496515

IUPAC4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1ccc(NC(=O)C(C)C(C)C(=O)O)c([N+](=O)[O-])c1
InChIInChI=1S/C13H16N2O6/c1-7(8(2)13(17)18)12(16)14-10-5-4-9(21-3)6-11(10)15(19)20/h4-8H,1-3H3,(H,14,16)(H,17,18)
InChIKeyGUZUXVHFIDVYHK-UHFFFAOYSA-N
MW296.28 g/mol
LogP1.90
Rot. Bonds6

About 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid

4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103496515) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID103496515
Molecular FormulaC13H16N2O6
Molecular Weight296.28 g/mol
Exact Mass296.10
IUPAC Name4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1ccc(NC(=O)C(C)C(C)C(=O)O)c([N+](=O)[O-])c1
InChIInChI=1S/C13H16N2O6/c1-7(8(2)13(17)18)12(16)14-10-5-4-9(21-3)6-11(10)15(19)20/h4-8H,1-3H3,(H,14,16)(H,17,18)
InChIKeyGUZUXVHFIDVYHK-UHFFFAOYSA-N
XLogP1.90
TPSA118.77 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.28
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid (CID 103496515) is 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid is COc1ccc(NC(=O)C(C)C(C)C(=O)O)c([N+](=O)[O-])c1.
What is the InChIKey of 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is GUZUXVHFIDVYHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O6/c1-7(8(2)13(17)18)12(16)14-10-5-4-9(21-3)6-11(10)15(19)20/h4-8H,1-3H3,(H,14,16)(H,17,18).
What are the key properties of 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid?
4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 296.28 g/mol, XLogP of 1.90, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxy-2-nitroanilino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103496515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).