C16H16NO3- — CID 7148291
(2R)-2-(2-methoxyanilino)-2-(4-methylphenyl)acetate (PubChem CID 7148291) has the molecular formula C16H16NO3- and a molecular weight of 270.31 g/mol. Its IUPAC name is (2R)-2-(2-methoxyanilino)-2-(4-methylphenyl)acetate.
| Compound Name | (2R)-2-(2-methoxyanilino)-2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 7148291 |
| Molecular Formula | C16H16NO3- |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2R)-2-(2-methoxyanilino)-2-(4-methylphenyl)acetate |
| SMILES | COc1ccccc1N[C@@H](C(=O)[O-])c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-11-7-9-12(10-8-11)15(16(18)19)17-13-5-3-4-6-14(13)20-2/h3-10,15,17H,1-2H3,(H,18,19)/p-1/t15-/m1/s1 |
| InChIKey | JFJDQCJOQVTAOH-OAHLLOKOSA-M |
| XLogP | 1.91 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |