C26H25N3O7 — CID 42963726
[2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 42963726) has the molecular formula C26H25N3O7 and a molecular weight of 491.50 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42963726 |
| Molecular Formula | C26H25N3O7 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)OC(C(=O)Nc1ccc(C)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C26H25N3O7/c1-3-35-22-12-8-7-11-19(22)25(31)27-16-23(30)36-24(18-9-5-4-6-10-18)26(32)28-20-14-13-17(2)15-21(20)29(33)34/h4-15,24H,3,16H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | SWDCGCJAJWLBOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|