C25H23N3O7S — CID 4841464
[2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-(2-phenylethenylsulfonylamino)acetate (PubChem CID 4841464) has the molecular formula C25H23N3O7S and a molecular weight of 509.54 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-(2-phenylethenylsulfonylamino)acetate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-(2-phenylethenylsulfonylamino)acetate |
|---|---|
| PubChem CID | 4841464 |
| Molecular Formula | C25H23N3O7S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 2-(2-phenylethenylsulfonylamino)acetate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)CNS(=O)(=O)C=Cc2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H23N3O7S/c1-18-12-13-21(22(16-18)28(31)32)27-25(30)24(20-10-6-3-7-11-20)35-23(29)17-26-36(33,34)15-14-19-8-4-2-5-9-19/h2-16,24,26H,17H2,1H3,(H,27,30) |
| InChIKey | FOIBACWBTLMMSN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|