C21H14N2O7S — CID 16740302
N-(4-methoxy-2-nitrophenyl)-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 16740302) has the molecular formula C21H14N2O7S and a molecular weight of 438.42 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 16740302 |
| Molecular Formula | C21H14N2O7S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N2O7S/c1-30-13-7-9-16(17(11-13)23(26)27)22-21(25)12-6-8-15-19(10-12)31(28,29)18-5-3-2-4-14(18)20(15)24/h2-11H,1H3,(H,22,25) |
| InChIKey | RWZCNCQTSJJHNR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|