C22H16N4O6 — CID 2902448
4-[(1,3-dioxoisoindol-2-yl)amino]-N-(4-methoxyphenyl)-3-nitrobenzamide (PubChem CID 2902448) has the molecular formula C22H16N4O6 and a molecular weight of 432.39 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)amino]-N-(4-methoxyphenyl)-3-nitrobenzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)amino]-N-(4-methoxyphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 2902448 |
| Molecular Formula | C22H16N4O6 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)amino]-N-(4-methoxyphenyl)-3-nitrobenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NN3C(=O)c4ccccc4C3=O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H16N4O6/c1-32-15-9-7-14(8-10-15)23-20(27)13-6-11-18(19(12-13)26(30)31)24-25-21(28)16-4-2-3-5-17(16)22(25)29/h2-12,24H,1H3,(H,23,27) |
| InChIKey | ULWHGNYXJBADCB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|