C21H16N4O8 — CID 5241323
4-[[4-(4-methoxyanilino)-3,5-dinitrobenzoyl]amino]benzoic acid (PubChem CID 5241323) has the molecular formula C21H16N4O8 and a molecular weight of 452.38 g/mol. Its IUPAC name is 4-[[4-(4-methoxyanilino)-3,5-dinitrobenzoyl]amino]benzoic acid.
| Compound Name | 4-[[4-(4-methoxyanilino)-3,5-dinitrobenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 5241323 |
| Molecular Formula | C21H16N4O8 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 4-[[4-(4-methoxyanilino)-3,5-dinitrobenzoyl]amino]benzoic acid |
| SMILES | COc1ccc(Nc2c([N+](=O)[O-])cc(C(=O)Nc3ccc(C(=O)O)cc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N4O8/c1-33-16-8-6-14(7-9-16)22-19-17(24(29)30)10-13(11-18(19)25(31)32)20(26)23-15-4-2-12(3-5-15)21(27)28/h2-11,22H,1H3,(H,23,26)(H,27,28) |
| InChIKey | UZLGDHHEXDZZCU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|