C17H16N4O8 — CID 10597335
4-[[1-(4-methoxyanilino)-1-oxopropan-2-yl]amino]-3,5-dinitrobenzoic acid (PubChem CID 10597335) has the molecular formula C17H16N4O8 and a molecular weight of 404.34 g/mol. Its IUPAC name is 4-[[1-(4-methoxyanilino)-1-oxopropan-2-yl]amino]-3,5-dinitrobenzoic acid.
| Compound Name | 4-[[1-(4-methoxyanilino)-1-oxopropan-2-yl]amino]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 10597335 |
| Molecular Formula | C17H16N4O8 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-[[1-(4-methoxyanilino)-1-oxopropan-2-yl]amino]-3,5-dinitrobenzoic acid |
| SMILES | COc1ccc(NC(=O)C(C)Nc2c([N+](=O)[O-])cc(C(=O)O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N4O8/c1-9(16(22)19-11-3-5-12(29-2)6-4-11)18-15-13(20(25)26)7-10(17(23)24)8-14(15)21(27)28/h3-9,18H,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | FTIRTXDRBHYOEL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|