C22H19F2N3O5 — CID 46674453
N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-4-(methylamino)-3-nitrobenzamide (PubChem CID 46674453) has the molecular formula C22H19F2N3O5 and a molecular weight of 443.41 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-4-(methylamino)-3-nitrobenzamide.
| Compound Name | N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-4-(methylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 46674453 |
| Molecular Formula | C22H19F2N3O5 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-4-(methylamino)-3-nitrobenzamide |
| SMILES | CNc1ccc(C(=O)Nc2ccc(OC(F)F)c(-c3ccc(OC)cc3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19F2N3O5/c1-25-18-9-5-14(11-19(18)27(29)30)21(28)26-15-6-10-20(32-22(23)24)17(12-15)13-3-7-16(31-2)8-4-13/h3-12,22,25H,1-2H3,(H,26,28) |
| InChIKey | ODTCDQBQIHKSPO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|