C23H21F2NO5S — CID 55369373
N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-methyl-5-methylsulfonylbenzamide (PubChem CID 55369373) has the molecular formula C23H21F2NO5S and a molecular weight of 461.49 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-methyl-5-methylsulfonylbenzamide.
| Compound Name | N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55369373 |
| Molecular Formula | C23H21F2NO5S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-2-methyl-5-methylsulfonylbenzamide |
| SMILES | COc1ccc(-c2cc(NC(=O)c3cc(S(C)(=O)=O)ccc3C)ccc2OC(F)F)cc1 |
| InChI | InChI=1S/C23H21F2NO5S/c1-14-4-10-18(32(3,28)29)13-19(14)22(27)26-16-7-11-21(31-23(24)25)20(12-16)15-5-8-17(30-2)9-6-15/h4-13,23H,1-3H3,(H,26,27) |
| InChIKey | ZEWCAHYNCIJNRM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |