C21H17F2N3O5 — CID 37040670
4-amino-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-nitrobenzamide (PubChem CID 37040670) has the molecular formula C21H17F2N3O5 and a molecular weight of 429.38 g/mol. Its IUPAC name is 4-amino-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 37040670 |
| Molecular Formula | C21H17F2N3O5 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 4-amino-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-nitrobenzamide |
| SMILES | COc1ccc(-c2cc(NC(=O)c3ccc(N)c([N+](=O)[O-])c3)ccc2OC(F)F)cc1 |
| InChI | InChI=1S/C21H17F2N3O5/c1-30-15-6-2-12(3-7-15)16-11-14(5-9-19(16)31-21(22)23)25-20(27)13-4-8-17(24)18(10-13)26(28)29/h2-11,21H,24H2,1H3,(H,25,27) |
| InChIKey | PGPNAUQGZQYCJV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|