C16H15F2N3O5 — CID 25348553
N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(methylamino)-3-nitrobenzamide (PubChem CID 25348553) has the molecular formula C16H15F2N3O5 and a molecular weight of 367.31 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(methylamino)-3-nitrobenzamide.
| Compound Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(methylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 25348553 |
| Molecular Formula | C16H15F2N3O5 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-4-(methylamino)-3-nitrobenzamide |
| SMILES | CNc1ccc(C(=O)Nc2ccc(OC)c(OC(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15F2N3O5/c1-19-11-5-3-9(7-12(11)21(23)24)15(22)20-10-4-6-13(25-2)14(8-10)26-16(17)18/h3-8,16,19H,1-2H3,(H,20,22) |
| InChIKey | BHZLWJFNYYSZAL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|