C18H16F2N2O8 — CID 41407102
[2-(4-methoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 41407102) has the molecular formula C18H16F2N2O8 and a molecular weight of 426.33 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 41407102 |
| Molecular Formula | C18H16F2N2O8 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(OC)c(OC(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16F2N2O8/c1-27-11-5-3-10(4-6-11)21-16(23)9-29-17(24)12-7-14(28-2)15(30-18(19)20)8-13(12)22(25)26/h3-8,18H,9H2,1-2H3,(H,21,23) |
| InChIKey | JKTQELJQPSGEER-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|