C16H13F2N3O8S — CID 41407219
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 41407219) has the molecular formula C16H13F2N3O8S and a molecular weight of 445.36 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 41407219 |
| Molecular Formula | C16H13F2N3O8S |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2sccc2C(N)=O)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C16H13F2N3O8S/c1-27-10-4-8(9(21(25)26)5-11(10)29-16(17)18)15(24)28-6-12(22)20-14-7(13(19)23)2-3-30-14/h2-5,16H,6H2,1H3,(H2,19,23)(H,20,22) |
| InChIKey | NNNLXORCLUHRLI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|