C18H13F5N2O7 — CID 46676058
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 46676058) has the molecular formula C18H13F5N2O7 and a molecular weight of 464.30 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 46676058 |
| Molecular Formula | C18H13F5N2O7 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2cccc(C(F)(F)F)c2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C18H13F5N2O7/c1-30-13-6-11(12(25(28)29)7-14(13)32-17(19)20)16(27)31-8-15(26)24-10-4-2-3-9(5-10)18(21,22)23/h2-7,17H,8H2,1H3,(H,24,26) |
| InChIKey | FJHOUZSXVMPCRH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|