C17H12F5NO6 — CID 46676106
[3-(trifluoromethyl)phenyl]methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 46676106) has the molecular formula C17H12F5NO6 and a molecular weight of 421.27 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 46676106 |
| Molecular Formula | C17H12F5NO6 |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCc2cccc(C(F)(F)F)c2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C17H12F5NO6/c1-27-13-6-11(12(23(25)26)7-14(13)29-16(18)19)15(24)28-8-9-3-2-4-10(5-9)17(20,21)22/h2-7,16H,8H2,1H3 |
| InChIKey | XNHDLNWSAFDUTQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|