C19H15F2N3O7 — CID 46675901
(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 46675901) has the molecular formula C19H15F2N3O7 and a molecular weight of 435.34 g/mol. Its IUPAC name is (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 46675901 |
| Molecular Formula | C19H15F2N3O7 |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCc2cc(=O)n3cccc(C)c3n2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H15F2N3O7/c1-10-4-3-5-23-16(25)6-11(22-17(10)23)9-30-18(26)12-7-14(29-2)15(31-19(20)21)8-13(12)24(27)28/h3-8,19H,9H2,1-2H3 |
| InChIKey | IBXCXIPUVYQAQT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|