C16H12F3NO6 — CID 46676068
(3-fluorophenyl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 46676068) has the molecular formula C16H12F3NO6 and a molecular weight of 371.27 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | (3-fluorophenyl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 46676068 |
| Molecular Formula | C16H12F3NO6 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (3-fluorophenyl)methyl 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCc2cccc(F)c2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C16H12F3NO6/c1-24-13-6-11(12(20(22)23)7-14(13)26-16(18)19)15(21)25-8-9-3-2-4-10(17)5-9/h2-7,16H,8H2,1H3 |
| InChIKey | ZZCRLYCAXUXWRR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|