C16H14BrNO6 — CID 2629993
(4-bromophenyl)methyl 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 2629993) has the molecular formula C16H14BrNO6 and a molecular weight of 396.19 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | (4-bromophenyl)methyl 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 2629993 |
| Molecular Formula | C16H14BrNO6 |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | (4-bromophenyl)methyl 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCc2ccc(Br)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H14BrNO6/c1-22-14-7-12(13(18(20)21)8-15(14)23-2)16(19)24-9-10-3-5-11(17)6-4-10/h3-8H,9H2,1-2H3 |
| InChIKey | SLHZLBPZPRKCER-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|