C17H12Cl2F2N2O7 — CID 46676097
[2-(2,6-dichloroanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 46676097) has the molecular formula C17H12Cl2F2N2O7 and a molecular weight of 465.19 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 46676097 |
| Molecular Formula | C17H12Cl2F2N2O7 |
| Molecular Weight | 465.19 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2c(Cl)cccc2Cl)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C17H12Cl2F2N2O7/c1-28-12-5-8(11(23(26)27)6-13(12)30-17(20)21)16(25)29-7-14(24)22-15-9(18)3-2-4-10(15)19/h2-6,17H,7H2,1H3,(H,22,24) |
| InChIKey | VPDYVJUZBUJXJX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|