C25H24N2O5S — CID 25352459
[(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate (PubChem CID 25352459) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate.
| Compound Name | [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 25352459 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [(1R)-2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@H](OC(=O)c2cc3c(s2)CCCCC3)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H24N2O5S/c1-16-12-13-19(20(14-16)27(30)31)26-24(28)23(17-8-4-2-5-9-17)32-25(29)22-15-18-10-6-3-7-11-21(18)33-22/h2,4-5,8-9,12-15,23H,3,6-7,10-11H2,1H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | UXVNJJFKDBEQJB-HSZRJFAPSA-N |
| XLogP | 5.77 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|