C23H25N3O6 — CID 42928905
[2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 1-acetylpiperidine-3-carboxylate (PubChem CID 42928905) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 1-acetylpiperidine-3-carboxylate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 1-acetylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 42928905 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxo-1-phenylethyl] 1-acetylpiperidine-3-carboxylate |
| SMILES | CC(=O)N1CCCC(C(=O)OC(C(=O)Nc2ccc(C)cc2[N+](=O)[O-])c2ccccc2)C1 |
| InChI | InChI=1S/C23H25N3O6/c1-15-10-11-19(20(13-15)26(30)31)24-22(28)21(17-7-4-3-5-8-17)32-23(29)18-9-6-12-25(14-18)16(2)27/h3-5,7-8,10-11,13,18,21H,6,9,12,14H2,1-2H3,(H,24,28) |
| InChIKey | RJRHOVKOSFUZDG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|