C28H25BrClN3O6 — CID 166352365
[2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-bromo-2-methylbenzoyl)piperidine-3-carboxylate (PubChem CID 166352365) has the molecular formula C28H25BrClN3O6 and a molecular weight of 614.88 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-bromo-2-methylbenzoyl)piperidine-3-carboxylate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-bromo-2-methylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 166352365 |
| Molecular Formula | C28H25BrClN3O6 |
| Molecular Weight | 614.88 g/mol |
| Exact Mass | 613.06 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-bromo-2-methylbenzoyl)piperidine-3-carboxylate |
| SMILES | Cc1cc(Br)ccc1C(=O)N1CCCC(C(=O)OC(C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H25BrClN3O6/c1-17-14-20(29)9-11-22(17)27(35)32-13-5-8-19(16-32)28(36)39-25(18-6-3-2-4-7-18)26(34)31-21-10-12-23(30)24(15-21)33(37)38/h2-4,6-7,9-12,14-15,19,25H,5,8,13,16H2,1H3,(H,31,34) |
| InChIKey | AGOVFJXOQJBJHO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.88 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|