C26H22ClFN2O5 — CID 25398453
[(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 25398453) has the molecular formula C26H22ClFN2O5 and a molecular weight of 496.92 g/mol. Its IUPAC name is [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 25398453 |
| Molecular Formula | C26H22ClFN2O5 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)[C@@H](OC(=O)C1(c2ccc(F)cc2)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H22ClFN2O5/c27-21-13-12-20(16-22(21)30(33)34)29-24(31)23(17-6-2-1-3-7-17)35-25(32)26(14-4-5-15-26)18-8-10-19(28)11-9-18/h1-3,6-13,16,23H,4-5,14-15H2,(H,29,31)/t23-/m0/s1 |
| InChIKey | PNLODVCYNCPKFH-QHCPKHFHSA-N |
| XLogP | 6.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|