C20H14ClN3O6 — CID 18268134
N-(4-chloro-3-nitrophenyl)-2-(2-nitrophenoxy)-2-phenylacetamide (PubChem CID 18268134) has the molecular formula C20H14ClN3O6 and a molecular weight of 427.80 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-(2-nitrophenoxy)-2-phenylacetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-(2-nitrophenoxy)-2-phenylacetamide |
|---|---|
| PubChem CID | 18268134 |
| Molecular Formula | C20H14ClN3O6 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-(2-nitrophenoxy)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)C(Oc1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H14ClN3O6/c21-15-11-10-14(12-17(15)24(28)29)22-20(25)19(13-6-2-1-3-7-13)30-18-9-5-4-8-16(18)23(26)27/h1-12,19H,(H,22,25) |
| InChIKey | BSGSGJJXKNSOMQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|