C22H17ClN2O7S — CID 2528252
[(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 3-methylsulfonylbenzoate (PubChem CID 2528252) has the molecular formula C22H17ClN2O7S and a molecular weight of 488.91 g/mol. Its IUPAC name is [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 3-methylsulfonylbenzoate.
| Compound Name | [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2528252 |
| Molecular Formula | C22H17ClN2O7S |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | [(1S)-2-(4-chloro-3-nitroanilino)-2-oxo-1-phenylethyl] 3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cccc(C(=O)O[C@H](C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H17ClN2O7S/c1-33(30,31)17-9-5-8-15(12-17)22(27)32-20(14-6-3-2-4-7-14)21(26)24-16-10-11-18(23)19(13-16)25(28)29/h2-13,20H,1H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | YVBBQWKDKQVPRJ-FQEVSTJZSA-N |
| XLogP | 4.19 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|