C22H15ClF3N3O5 — CID 25418690
[(1S)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate (PubChem CID 25418690) has the molecular formula C22H15ClF3N3O5 and a molecular weight of 493.83 g/mol. Its IUPAC name is [(1S)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [(1S)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 25418690 |
| Molecular Formula | C22H15ClF3N3O5 |
| Molecular Weight | 493.83 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | [(1S)-2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)O[C@H](C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15ClF3N3O5/c23-16-8-7-14(11-15(16)22(24,25)26)28-20(30)19(12-4-2-1-3-5-12)34-21(31)13-6-9-17(27)18(10-13)29(32)33/h1-11,19H,27H2,(H,28,30)/t19-/m0/s1 |
| InChIKey | JQVOLJQDFGTYES-IBGZPJMESA-N |
| XLogP | 5.39 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|