C21H15ClN4O7 — CID 43012393
[2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate (PubChem CID 43012393) has the molecular formula C21H15ClN4O7 and a molecular weight of 470.83 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 43012393 |
| Molecular Formula | C21H15ClN4O7 |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)OC(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15ClN4O7/c22-15-11-14(25(29)30)7-9-17(15)24-20(27)19(12-4-2-1-3-5-12)33-21(28)13-6-8-16(23)18(10-13)26(31)32/h1-11,19H,23H2,(H,24,27) |
| InChIKey | VAKLOKQLVXRCCK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 167.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|