C25H21Cl2N3O7S — CID 98415695
[(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 98415695) has the molecular formula C25H21Cl2N3O7S and a molecular weight of 578.43 g/mol. Its IUPAC name is [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 98415695 |
| Molecular Formula | C25H21Cl2N3O7S |
| Molecular Weight | 578.43 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(O[C@H](C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C25H21Cl2N3O7S/c26-19-10-8-17(14-22(19)38(35,36)29-12-4-5-13-29)25(32)37-23(16-6-2-1-3-7-16)24(31)28-21-11-9-18(30(33)34)15-20(21)27/h1-3,6-11,14-15,23H,4-5,12-13H2,(H,28,31)/t23-/m0/s1 |
| InChIKey | NRAMWKLWKDXFLT-QHCPKHFHSA-N |
| XLogP | 5.22 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|