C21H15Cl2N3O5 — CID 24569584
[2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 3-amino-4-chlorobenzoate (PubChem CID 24569584) has the molecular formula C21H15Cl2N3O5 and a molecular weight of 460.27 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 24569584 |
| Molecular Formula | C21H15Cl2N3O5 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OC(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C21H15Cl2N3O5/c22-15-8-6-13(10-17(15)24)21(28)31-19(12-4-2-1-3-5-12)20(27)25-18-9-7-14(26(29)30)11-16(18)23/h1-11,19H,24H2,(H,25,27) |
| InChIKey | JVGFWSFIOBWHJD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|