C22H15ClF2N2O6 — CID 46796455
[2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(difluoromethoxy)benzoate (PubChem CID 46796455) has the molecular formula C22H15ClF2N2O6 and a molecular weight of 476.82 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(difluoromethoxy)benzoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 46796455 |
| Molecular Formula | C22H15ClF2N2O6 |
| Molecular Weight | 476.82 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(difluoromethoxy)benzoate |
| SMILES | O=C(OC(C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C22H15ClF2N2O6/c23-16-12-14(27(30)31)10-11-17(16)26-20(28)19(13-6-2-1-3-7-13)33-21(29)15-8-4-5-9-18(15)32-22(24)25/h1-12,19,22H,(H,26,28) |
| InChIKey | LAUYUGYRXAJHCB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.82 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|