C25H18ClN3O7S2 — CID 25040906
[2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25040906) has the molecular formula C25H18ClN3O7S2 and a molecular weight of 572.02 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25040906 |
| Molecular Formula | C25H18ClN3O7S2 |
| Molecular Weight | 572.02 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(OC(C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C25H18ClN3O7S2/c26-19-15-17(29(32)33)12-13-21(19)27-24(30)23(16-7-2-1-3-8-16)36-25(31)18-9-4-5-10-20(18)28-38(34,35)22-11-6-14-37-22/h1-15,23,28H,(H,27,30) |
| InChIKey | LZKAJGRYGKMZSL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.02 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|