C20H16ClFN2O5S2 — CID 16539374
[1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 16539374) has the molecular formula C20H16ClFN2O5S2 and a molecular weight of 482.94 g/mol. Its IUPAC name is [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 16539374 |
| Molecular Formula | C20H16ClFN2O5S2 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NS(=O)(=O)c1cccs1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H16ClFN2O5S2/c1-12(19(25)23-17-9-8-13(22)11-15(17)21)29-20(26)14-5-2-3-6-16(14)24-31(27,28)18-7-4-10-30-18/h2-12,24H,1H3,(H,23,25) |
| InChIKey | DWPGSWKLKFFVJZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |