C23H20ClN3O8S — CID 98409622
[(2R)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)sulfonylamino]benzoate (PubChem CID 98409622) has the molecular formula C23H20ClN3O8S and a molecular weight of 533.95 g/mol. Its IUPAC name is [(2R)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)sulfonylamino]benzoate.
| Compound Name | [(2R)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 98409622 |
| Molecular Formula | C23H20ClN3O8S |
| Molecular Weight | 533.95 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | [(2R)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)sulfonylamino]benzoate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C(=O)O[C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O8S/c1-14(22(28)25-21-12-7-15(27(30)31)13-19(21)24)35-23(29)18-5-3-4-6-20(18)26-36(32,33)17-10-8-16(34-2)9-11-17/h3-14,26H,1-2H3,(H,25,28)/t14-/m1/s1 |
| InChIKey | NFQYNNRGHYTKAL-CQSZACIVSA-N |
| XLogP | 4.24 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.95 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|